C13H16N2OS — CID 86804525
2-ethoxy-N-methyl-N-(1,3-thiazol-5-ylmethyl)aniline (PubChem CID 86804525) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-ethoxy-N-methyl-N-(1,3-thiazol-5-ylmethyl)aniline.
| Compound Name | 2-ethoxy-N-methyl-N-(1,3-thiazol-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 86804525 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-ethoxy-N-methyl-N-(1,3-thiazol-5-ylmethyl)aniline |
| SMILES | CCOc1ccccc1N(C)Cc1cncs1 |
| InChI | InChI=1S/C13H16N2OS/c1-3-16-13-7-5-4-6-12(13)15(2)9-11-8-14-10-17-11/h4-8,10H,3,9H2,1-2H3 |
| InChIKey | QYGZSXUFYULLCW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |