C12H13ClN2OS — CID 86807167
3-[(2-chloro-1,3-thiazol-5-yl)methyl-ethylamino]phenol (PubChem CID 86807167) has the molecular formula C12H13ClN2OS and a molecular weight of 268.77 g/mol. Its IUPAC name is 3-[(2-chloro-1,3-thiazol-5-yl)methyl-ethylamino]phenol.
| Compound Name | 3-[(2-chloro-1,3-thiazol-5-yl)methyl-ethylamino]phenol |
|---|---|
| PubChem CID | 86807167 |
| Molecular Formula | C12H13ClN2OS |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 3-[(2-chloro-1,3-thiazol-5-yl)methyl-ethylamino]phenol |
| SMILES | CCN(Cc1cnc(Cl)s1)c1cccc(O)c1 |
| InChI | InChI=1S/C12H13ClN2OS/c1-2-15(8-11-7-14-12(13)17-11)9-4-3-5-10(16)6-9/h3-7,16H,2,8H2,1H3 |
| InChIKey | VLGHIGAEBHBUMV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |