C12H10F3N3O3S — CID 86807415
N-pyrimidin-2-yl-1-[4-(trifluoromethoxy)phenyl]methanesulfonamide (PubChem CID 86807415) has the molecular formula C12H10F3N3O3S and a molecular weight of 333.29 g/mol. Its IUPAC name is N-pyrimidin-2-yl-1-[4-(trifluoromethoxy)phenyl]methanesulfonamide.
| Compound Name | N-pyrimidin-2-yl-1-[4-(trifluoromethoxy)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 86807415 |
| Molecular Formula | C12H10F3N3O3S |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | N-pyrimidin-2-yl-1-[4-(trifluoromethoxy)phenyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(OC(F)(F)F)cc1)Nc1ncccn1 |
| InChI | InChI=1S/C12H10F3N3O3S/c13-12(14,15)21-10-4-2-9(3-5-10)8-22(19,20)18-11-16-6-1-7-17-11/h1-7H,8H2,(H,16,17,18) |
| InChIKey | PSXGUDVYMIKSEY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |