C14H12F3NO4S — CID 91020906
[4-[4-(trifluoromethoxy)phenoxy]phenyl]methanesulfonamide (PubChem CID 91020906) has the molecular formula C14H12F3NO4S and a molecular weight of 347.31 g/mol. Its IUPAC name is [4-[4-(trifluoromethoxy)phenoxy]phenyl]methanesulfonamide.
| Compound Name | [4-[4-(trifluoromethoxy)phenoxy]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 91020906 |
| Molecular Formula | C14H12F3NO4S |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | [4-[4-(trifluoromethoxy)phenoxy]phenyl]methanesulfonamide |
| SMILES | NS(=O)(=O)Cc1ccc(Oc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C14H12F3NO4S/c15-14(16,17)22-13-7-5-12(6-8-13)21-11-3-1-10(2-4-11)9-23(18,19)20/h1-8H,9H2,(H2,18,19,20) |
| InChIKey | ASDAXNICABONET-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |