C15H17NO4S — CID 86812829
[4-(cyclopropylmethoxy)phenyl] 2-(4-oxo-1,3-thiazolidin-3-yl)acetate (PubChem CID 86812829) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is [4-(cyclopropylmethoxy)phenyl] 2-(4-oxo-1,3-thiazolidin-3-yl)acetate.
| Compound Name | [4-(cyclopropylmethoxy)phenyl] 2-(4-oxo-1,3-thiazolidin-3-yl)acetate |
|---|---|
| PubChem CID | 86812829 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | [4-(cyclopropylmethoxy)phenyl] 2-(4-oxo-1,3-thiazolidin-3-yl)acetate |
| SMILES | O=C(CN1CSCC1=O)Oc1ccc(OCC2CC2)cc1 |
| InChI | InChI=1S/C15H17NO4S/c17-14-9-21-10-16(14)7-15(18)20-13-5-3-12(4-6-13)19-8-11-1-2-11/h3-6,11H,1-2,7-10H2 |
| InChIKey | SLUUQSSPNCMKDI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|