C15H16N4O2S — CID 86814249
N-benzyl-2-[(6-cyano-2-pyridinyl)amino]ethanesulfonamide (PubChem CID 86814249) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is N-benzyl-2-[(6-cyano-2-pyridinyl)amino]ethanesulfonamide.
| Compound Name | N-benzyl-2-[(6-cyano-2-pyridinyl)amino]ethanesulfonamide |
|---|---|
| PubChem CID | 86814249 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-benzyl-2-[(6-cyano-2-pyridinyl)amino]ethanesulfonamide |
| SMILES | N#Cc1cccc(NCCS(=O)(=O)NCc2ccccc2)n1 |
| InChI | InChI=1S/C15H16N4O2S/c16-11-14-7-4-8-15(19-14)17-9-10-22(20,21)18-12-13-5-2-1-3-6-13/h1-8,18H,9-10,12H2,(H,17,19) |
| InChIKey | KOQOSTORQPYOJR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |