About 6-[2-(2,4-dioxopyrimidin-1-yl)ethylamino]pyridine-2-carbonitrile
6-[2-(2,4-dioxopyrimidin-1-yl)ethylamino]pyridine-2-carbonitrile (PubChem CID 167888568) has the molecular formula C12H11N5O2
and a molecular weight of 257.25 g/mol. Its IUPAC name is 6-[2-(2,4-dioxopyrimidin-1-yl)ethylamino]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 6-[2-(2,4-dioxopyrimidin-1-yl)ethylamino]pyridine-2-carbonitrile |
| PubChem CID | 167888568 |
| Molecular Formula | C12H11N5O2 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 6-[2-(2,4-dioxopyrimidin-1-yl)ethylamino]pyridine-2-carbonitrile |
| SMILES | N#Cc1cccc(NCCn2ccc(=O)[nH]c2=O)n1 |
| InChI | InChI=1S/C12H11N5O2/c13-8-9-2-1-3-10(15-9)14-5-7-17-6-4-11(18)16-12(17)19/h1-4,6H,5,7H2,(H,14,15)(H,16,18,19) |
| InChIKey | ICXJPZOKLQEAHK-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 103.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[2-(2,4-dioxopyrimidin-1-yl)ethylamino]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(2,4-dioxopyrimidin-1-yl)ethylamino]pyridine-2-carbonitrile?
The IUPAC name of 6-[2-(2,4-dioxopyrimidin-1-yl)ethylamino]pyridine-2-carbonitrile (CID 167888568) is 6-[2-(2,4-dioxopyrimidin-1-yl)ethylamino]pyridine-2-carbonitrile.
What is the SMILES notation for 6-[2-(2,4-dioxopyrimidin-1-yl)ethylamino]pyridine-2-carbonitrile?
The canonical SMILES for 6-[2-(2,4-dioxopyrimidin-1-yl)ethylamino]pyridine-2-carbonitrile is N#Cc1cccc(NCCn2ccc(=O)[nH]c2=O)n1.
What is the InChIKey of 6-[2-(2,4-dioxopyrimidin-1-yl)ethylamino]pyridine-2-carbonitrile?
The InChIKey is ICXJPZOKLQEAHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5O2/c13-8-9-2-1-3-10(15-9)14-5-7-17-6-4-11(18)16-12(17)19/h1-4,6H,5,7H2,(H,14,15)(H,16,18,19).
What are the key properties of 6-[2-(2,4-dioxopyrimidin-1-yl)ethylamino]pyridine-2-carbonitrile?
6-[2-(2,4-dioxopyrimidin-1-yl)ethylamino]pyridine-2-carbonitrile has a molecular weight of 257.25 g/mol, XLogP of -0.08, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(2,4-dioxopyrimidin-1-yl)ethylamino]pyridine-2-carbonitrile is sourced from PubChem (CID 167888568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).