C20H26N2S — CID 8681429
3-(2,3-dimethylphenyl)-1-methyl-1-[(4-propan-2-ylphenyl)methyl]thiourea (PubChem CID 8681429) has the molecular formula C20H26N2S and a molecular weight of 326.51 g/mol. Its IUPAC name is 3-(2,3-dimethylphenyl)-1-methyl-1-[(4-propan-2-ylphenyl)methyl]thiourea.
| Compound Name | 3-(2,3-dimethylphenyl)-1-methyl-1-[(4-propan-2-ylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 8681429 |
| Molecular Formula | C20H26N2S |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 3-(2,3-dimethylphenyl)-1-methyl-1-[(4-propan-2-ylphenyl)methyl]thiourea |
| SMILES | Cc1cccc(NC(=S)N(C)Cc2ccc(C(C)C)cc2)c1C |
| InChI | InChI=1S/C20H26N2S/c1-14(2)18-11-9-17(10-12-18)13-22(5)20(23)21-19-8-6-7-15(3)16(19)4/h6-12,14H,13H2,1-5H3,(H,21,23) |
| InChIKey | GKKKVCMWWMNISL-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|