C17H26N2O2S2 — CID 8681499
[2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl] N,N-diethylcarbamodithioate (PubChem CID 8681499) has the molecular formula C17H26N2O2S2 and a molecular weight of 354.54 g/mol. Its IUPAC name is [2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl] N,N-diethylcarbamodithioate.
| Compound Name | [2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 8681499 |
| Molecular Formula | C17H26N2O2S2 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | [2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC(=O)NCCOc1ccc(C)cc1C |
| InChI | InChI=1S/C17H26N2O2S2/c1-5-19(6-2)17(22)23-12-16(20)18-9-10-21-15-8-7-13(3)11-14(15)4/h7-8,11H,5-6,9-10,12H2,1-4H3,(H,18,20) |
| InChIKey | FNYTVUYEIZYZIU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|