C20H27ClN4O2S — CID 86815340
4-(2-chlorophenyl)-3-[3-(oxan-2-yloxy)propylsulfanyl]-5-pyrrolidin-1-yl-1,2,4-triazole (PubChem CID 86815340) has the molecular formula C20H27ClN4O2S and a molecular weight of 422.98 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-3-[3-(oxan-2-yloxy)propylsulfanyl]-5-pyrrolidin-1-yl-1,2,4-triazole.
| Compound Name | 4-(2-chlorophenyl)-3-[3-(oxan-2-yloxy)propylsulfanyl]-5-pyrrolidin-1-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 86815340 |
| Molecular Formula | C20H27ClN4O2S |
| Molecular Weight | 422.98 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 4-(2-chlorophenyl)-3-[3-(oxan-2-yloxy)propylsulfanyl]-5-pyrrolidin-1-yl-1,2,4-triazole |
| SMILES | Clc1ccccc1-n1c(SCCCOC2CCCCO2)nnc1N1CCCC1 |
| InChI | InChI=1S/C20H27ClN4O2S/c21-16-8-1-2-9-17(16)25-19(24-11-4-5-12-24)22-23-20(25)28-15-7-14-27-18-10-3-6-13-26-18/h1-2,8-9,18H,3-7,10-15H2 |
| InChIKey | ARNVHSCXOLKTNH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.98 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|