C13H17N3OS — CID 86816772
1-methoxy-2-phenyl-N-(thiadiazol-4-ylmethyl)propan-2-amine (PubChem CID 86816772) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is 1-methoxy-2-phenyl-N-(thiadiazol-4-ylmethyl)propan-2-amine.
| Compound Name | 1-methoxy-2-phenyl-N-(thiadiazol-4-ylmethyl)propan-2-amine |
|---|---|
| PubChem CID | 86816772 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 1-methoxy-2-phenyl-N-(thiadiazol-4-ylmethyl)propan-2-amine |
| SMILES | COCC(C)(NCc1csnn1)c1ccccc1 |
| InChI | InChI=1S/C13H17N3OS/c1-13(10-17-2,11-6-4-3-5-7-11)14-8-12-9-18-16-15-12/h3-7,9,14H,8,10H2,1-2H3 |
| InChIKey | ACMRMKWNSBXZNJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |