C18H23N3S — CID 8681685
(1R)-N-(2,3-dimethylphenyl)-1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide (PubChem CID 8681685) has the molecular formula C18H23N3S and a molecular weight of 313.47 g/mol. Its IUPAC name is (1R)-N-(2,3-dimethylphenyl)-1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide.
| Compound Name | (1R)-N-(2,3-dimethylphenyl)-1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 8681685 |
| Molecular Formula | C18H23N3S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | (1R)-N-(2,3-dimethylphenyl)-1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbothioamide |
| SMILES | Cc1cccc(NC(=S)N2CCn3c(C)ccc3[C@H]2C)c1C |
| InChI | InChI=1S/C18H23N3S/c1-12-6-5-7-16(14(12)3)19-18(22)21-11-10-20-13(2)8-9-17(20)15(21)4/h5-9,15H,10-11H2,1-4H3,(H,19,22)/t15-/m1/s1 |
| InChIKey | OSOXIOBVYOZNAM-OAHLLOKOSA-N |
| XLogP | 4.19 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|