About N-tert-butyl-2-(3,4-difluorophenyl)-N-(2-methylsulfonylethyl)acetamide
N-tert-butyl-2-(3,4-difluorophenyl)-N-(2-methylsulfonylethyl)acetamide (PubChem CID 86816870) has the molecular formula C15H21F2NO3S
and a molecular weight of 333.40 g/mol. Its IUPAC name is N-tert-butyl-2-(3,4-difluorophenyl)-N-(2-methylsulfonylethyl)acetamide.
Molecular Properties
| Compound Name | N-tert-butyl-2-(3,4-difluorophenyl)-N-(2-methylsulfonylethyl)acetamide |
| PubChem CID | 86816870 |
| Molecular Formula | C15H21F2NO3S |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | N-tert-butyl-2-(3,4-difluorophenyl)-N-(2-methylsulfonylethyl)acetamide |
| SMILES | CC(C)(C)N(CCS(C)(=O)=O)C(=O)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H21F2NO3S/c1-15(2,3)18(7-8-22(4,20)21)14(19)10-11-5-6-12(16)13(17)9-11/h5-6,9H,7-8,10H2,1-4H3 |
| InChIKey | UROICFYRESNDCE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-2-(3,4-difluorophenyl)-N-(2-methylsulfonylethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-(3,4-difluorophenyl)-N-(2-methylsulfonylethyl)acetamide?
The IUPAC name of N-tert-butyl-2-(3,4-difluorophenyl)-N-(2-methylsulfonylethyl)acetamide (CID 86816870) is N-tert-butyl-2-(3,4-difluorophenyl)-N-(2-methylsulfonylethyl)acetamide.
What is the SMILES notation for N-tert-butyl-2-(3,4-difluorophenyl)-N-(2-methylsulfonylethyl)acetamide?
The canonical SMILES for N-tert-butyl-2-(3,4-difluorophenyl)-N-(2-methylsulfonylethyl)acetamide is CC(C)(C)N(CCS(C)(=O)=O)C(=O)Cc1ccc(F)c(F)c1.
What is the InChIKey of N-tert-butyl-2-(3,4-difluorophenyl)-N-(2-methylsulfonylethyl)acetamide?
The InChIKey is UROICFYRESNDCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F2NO3S/c1-15(2,3)18(7-8-22(4,20)21)14(19)10-11-5-6-12(16)13(17)9-11/h5-6,9H,7-8,10H2,1-4H3.
What are the key properties of N-tert-butyl-2-(3,4-difluorophenyl)-N-(2-methylsulfonylethyl)acetamide?
N-tert-butyl-2-(3,4-difluorophenyl)-N-(2-methylsulfonylethyl)acetamide has a molecular weight of 333.40 g/mol, XLogP of 2.18, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-(3,4-difluorophenyl)-N-(2-methylsulfonylethyl)acetamide is sourced from PubChem (CID 86816870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).