C19H26FN3O2 — CID 86818176
N-(4-ethyl-3-fluorophenyl)-2-(6-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl)-2-oxoacetamide (PubChem CID 86818176) has the molecular formula C19H26FN3O2 and a molecular weight of 347.43 g/mol. Its IUPAC name is N-(4-ethyl-3-fluorophenyl)-2-(6-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl)-2-oxoacetamide.
| Compound Name | N-(4-ethyl-3-fluorophenyl)-2-(6-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 86818176 |
| Molecular Formula | C19H26FN3O2 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-(4-ethyl-3-fluorophenyl)-2-(6-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl)-2-oxoacetamide |
| SMILES | CCc1ccc(NC(=O)C(=O)N2CCCC3CN(C)CCC32)cc1F |
| InChI | InChI=1S/C19H26FN3O2/c1-3-13-6-7-15(11-16(13)20)21-18(24)19(25)23-9-4-5-14-12-22(2)10-8-17(14)23/h6-7,11,14,17H,3-5,8-10,12H2,1-2H3,(H,21,24) |
| InChIKey | BOUOGAAGPBLTPW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|