C17H19F2N3O2 — CID 86818203
N'-(2,2-difluoroethyl)-N-(2-methylquinolin-8-yl)-N'-propan-2-yloxamide (PubChem CID 86818203) has the molecular formula C17H19F2N3O2 and a molecular weight of 335.35 g/mol. Its IUPAC name is N'-(2,2-difluoroethyl)-N-(2-methylquinolin-8-yl)-N'-propan-2-yloxamide.
| Compound Name | N'-(2,2-difluoroethyl)-N-(2-methylquinolin-8-yl)-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 86818203 |
| Molecular Formula | C17H19F2N3O2 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N'-(2,2-difluoroethyl)-N-(2-methylquinolin-8-yl)-N'-propan-2-yloxamide |
| SMILES | Cc1ccc2cccc(NC(=O)C(=O)N(CC(F)F)C(C)C)c2n1 |
| InChI | InChI=1S/C17H19F2N3O2/c1-10(2)22(9-14(18)19)17(24)16(23)21-13-6-4-5-12-8-7-11(3)20-15(12)13/h4-8,10,14H,9H2,1-3H3,(H,21,23) |
| InChIKey | HGHFRZSEBNXINX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|