C15H14N2OS — CID 86818870
5-methyl-4-[2-(2-phenylethyl)-1,3-thiazol-4-yl]-1,2-oxazole (PubChem CID 86818870) has the molecular formula C15H14N2OS and a molecular weight of 270.36 g/mol. Its IUPAC name is 5-methyl-4-[2-(2-phenylethyl)-1,3-thiazol-4-yl]-1,2-oxazole.
| Compound Name | 5-methyl-4-[2-(2-phenylethyl)-1,3-thiazol-4-yl]-1,2-oxazole |
|---|---|
| PubChem CID | 86818870 |
| Molecular Formula | C15H14N2OS |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 5-methyl-4-[2-(2-phenylethyl)-1,3-thiazol-4-yl]-1,2-oxazole |
| SMILES | Cc1oncc1-c1csc(CCc2ccccc2)n1 |
| InChI | InChI=1S/C15H14N2OS/c1-11-13(9-16-18-11)14-10-19-15(17-14)8-7-12-5-3-2-4-6-12/h2-6,9-10H,7-8H2,1H3 |
| InChIKey | WJRHHAMCRGLWMU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |