C19H31N3OS — CID 86820342
1-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)-3-(3-methyl-1-thiophen-2-ylbutyl)urea (PubChem CID 86820342) has the molecular formula C19H31N3OS and a molecular weight of 349.54 g/mol. Its IUPAC name is 1-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)-3-(3-methyl-1-thiophen-2-ylbutyl)urea.
| Compound Name | 1-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)-3-(3-methyl-1-thiophen-2-ylbutyl)urea |
|---|---|
| PubChem CID | 86820342 |
| Molecular Formula | C19H31N3OS |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 1-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)-3-(3-methyl-1-thiophen-2-ylbutyl)urea |
| SMILES | CC(C)CC(NC(=O)NC1CC2CCCC(C1)N2C)c1cccs1 |
| InChI | InChI=1S/C19H31N3OS/c1-13(2)10-17(18-8-5-9-24-18)21-19(23)20-14-11-15-6-4-7-16(12-14)22(15)3/h5,8-9,13-17H,4,6-7,10-12H2,1-3H3,(H2,20,21,23) |
| InChIKey | PNCKIKRPDOMCKT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |