C18H27N3OS — CID 98203059
(3S)-3-(2,5-dihydropyrrol-1-yl)-N-[(1R)-3-methyl-1-thiophen-2-ylbutyl]pyrrolidine-1-carboxamide (PubChem CID 98203059) has the molecular formula C18H27N3OS and a molecular weight of 333.50 g/mol. Its IUPAC name is (3S)-3-(2,5-dihydropyrrol-1-yl)-N-[(1R)-3-methyl-1-thiophen-2-ylbutyl]pyrrolidine-1-carboxamide.
| Compound Name | (3S)-3-(2,5-dihydropyrrol-1-yl)-N-[(1R)-3-methyl-1-thiophen-2-ylbutyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 98203059 |
| Molecular Formula | C18H27N3OS |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (3S)-3-(2,5-dihydropyrrol-1-yl)-N-[(1R)-3-methyl-1-thiophen-2-ylbutyl]pyrrolidine-1-carboxamide |
| SMILES | CC(C)C[C@@H](NC(=O)N1CC[C@H](N2CC=CC2)C1)c1cccs1 |
| InChI | InChI=1S/C18H27N3OS/c1-14(2)12-16(17-6-5-11-23-17)19-18(22)21-10-7-15(13-21)20-8-3-4-9-20/h3-6,11,14-16H,7-10,12-13H2,1-2H3,(H,19,22)/t15-,16+/m0/s1 |
| InChIKey | BKPCUWBQVIWVRQ-JKSUJKDBSA-N |
| XLogP | 3.49 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|