C20H33FN4O3S — CID 86823530
5-(diethylsulfamoyl)-2-fluoro-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]benzamide (PubChem CID 86823530) has the molecular formula C20H33FN4O3S and a molecular weight of 428.57 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-2-fluoro-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]benzamide.
| Compound Name | 5-(diethylsulfamoyl)-2-fluoro-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 86823530 |
| Molecular Formula | C20H33FN4O3S |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 5-(diethylsulfamoyl)-2-fluoro-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)NCC(C)CN2CCN(C)CC2)c1 |
| InChI | InChI=1S/C20H33FN4O3S/c1-5-25(6-2)29(27,28)17-7-8-19(21)18(13-17)20(26)22-14-16(3)15-24-11-9-23(4)10-12-24/h7-8,13,16H,5-6,9-12,14-15H2,1-4H3,(H,22,26) |
| InChIKey | ZXBBJGFBEHKNHP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |