C20H24N2O2S — CID 8682661
3-(4-ethoxyphenyl)-1-methyl-1-[(4-prop-2-enoxyphenyl)methyl]thiourea (PubChem CID 8682661) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-1-methyl-1-[(4-prop-2-enoxyphenyl)methyl]thiourea.
| Compound Name | 3-(4-ethoxyphenyl)-1-methyl-1-[(4-prop-2-enoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 8682661 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 3-(4-ethoxyphenyl)-1-methyl-1-[(4-prop-2-enoxyphenyl)methyl]thiourea |
| SMILES | C=CCOc1ccc(CN(C)C(=S)Nc2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C20H24N2O2S/c1-4-14-24-19-10-6-16(7-11-19)15-22(3)20(25)21-17-8-12-18(13-9-17)23-5-2/h4,6-13H,1,5,14-15H2,2-3H3,(H,21,25) |
| InChIKey | MLKAFRQZPTVTSQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|