C17H15BrFNO2 — CID 86832844
N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-3-fluoro-4-methoxybenzamide (PubChem CID 86832844) has the molecular formula C17H15BrFNO2 and a molecular weight of 364.21 g/mol. Its IUPAC name is N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-3-fluoro-4-methoxybenzamide.
| Compound Name | N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-3-fluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 86832844 |
| Molecular Formula | C17H15BrFNO2 |
| Molecular Weight | 364.21 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-3-fluoro-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CCc3cc(Br)ccc32)cc1F |
| InChI | InChI=1S/C17H15BrFNO2/c1-22-16-7-3-11(9-14(16)19)17(21)20-15-6-2-10-8-12(18)4-5-13(10)15/h3-5,7-9,15H,2,6H2,1H3,(H,20,21) |
| InChIKey | YXPYEFKUJNJMES-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.21 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |