C17H15ClN4O3 — CID 86835010
ethyl 1-[4-[(4-chloro-1H-pyrrole-2-carbonyl)amino]phenyl]pyrazole-3-carboxylate (PubChem CID 86835010) has the molecular formula C17H15ClN4O3 and a molecular weight of 358.79 g/mol. Its IUPAC name is ethyl 1-[4-[(4-chloro-1H-pyrrole-2-carbonyl)amino]phenyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 1-[4-[(4-chloro-1H-pyrrole-2-carbonyl)amino]phenyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 86835010 |
| Molecular Formula | C17H15ClN4O3 |
| Molecular Weight | 358.79 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | ethyl 1-[4-[(4-chloro-1H-pyrrole-2-carbonyl)amino]phenyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1ccn(-c2ccc(NC(=O)c3cc(Cl)c[nH]3)cc2)n1 |
| InChI | InChI=1S/C17H15ClN4O3/c1-2-25-17(24)14-7-8-22(21-14)13-5-3-12(4-6-13)20-16(23)15-9-11(18)10-19-15/h3-10,19H,2H2,1H3,(H,20,23) |
| InChIKey | KNMNVJULBHEPEQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.79 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |