C21H20N2O6 — CID 174407348
ethyl 1-phenylpyrazole-3-carboxylate;5-methylbenzene-1,3-dicarboxylic acid (PubChem CID 174407348) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is ethyl 1-phenylpyrazole-3-carboxylate;5-methylbenzene-1,3-dicarboxylic acid.
| Compound Name | ethyl 1-phenylpyrazole-3-carboxylate;5-methylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174407348 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | ethyl 1-phenylpyrazole-3-carboxylate;5-methylbenzene-1,3-dicarboxylic acid |
| SMILES | CCOC(=O)c1ccn(-c2ccccc2)n1.Cc1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C12H12N2O2.C9H8O4/c1-2-16-12(15)11-8-9-14(13-11)10-6-4-3-5-7-10;1-5-2-6(8(10)11)4-7(3-5)9(12)13/h3-9H,2H2,1H3;2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | DJLOOHXCEPMDRI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |