C16H18ClN5O3S — CID 86837096
N-(2-chloro-4-nitrophenyl)-4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepane-1-carboxamide (PubChem CID 86837096) has the molecular formula C16H18ClN5O3S and a molecular weight of 395.87 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepane-1-carboxamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 86837096 |
| Molecular Formula | C16H18ClN5O3S |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-4-(4-methyl-1,3-thiazol-2-yl)-1,4-diazepane-1-carboxamide |
| SMILES | Cc1csc(N2CCCN(C(=O)Nc3ccc([N+](=O)[O-])cc3Cl)CC2)n1 |
| InChI | InChI=1S/C16H18ClN5O3S/c1-11-10-26-16(18-11)21-6-2-5-20(7-8-21)15(23)19-14-4-3-12(22(24)25)9-13(14)17/h3-4,9-10H,2,5-8H2,1H3,(H,19,23) |
| InChIKey | SMAGEAWOAHMAPL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|