C22H34N6O — CID 86837586
4-(3-cyano-2-pyridinyl)-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1,4-diazepane-1-carboxamide (PubChem CID 86837586) has the molecular formula C22H34N6O and a molecular weight of 398.56 g/mol. Its IUPAC name is 4-(3-cyano-2-pyridinyl)-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-(3-cyano-2-pyridinyl)-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 86837586 |
| Molecular Formula | C22H34N6O |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | 4-(3-cyano-2-pyridinyl)-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-1,4-diazepane-1-carboxamide |
| SMILES | CC1CC(C)CN(CCCNC(=O)N2CCCN(c3ncccc3C#N)CC2)C1 |
| InChI | InChI=1S/C22H34N6O/c1-18-14-19(2)17-26(16-18)9-4-8-25-22(29)28-11-5-10-27(12-13-28)21-20(15-23)6-3-7-24-21/h3,6-7,18-19H,4-5,8-14,16-17H2,1-2H3,(H,25,29) |
| InChIKey | XOVKUZNFYZKCEX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|