C15H19FN2O3S — CID 86841431
methyl 4-[[2-(4-fluorophenyl)sulfanylacetyl]amino]piperidine-1-carboxylate (PubChem CID 86841431) has the molecular formula C15H19FN2O3S and a molecular weight of 326.39 g/mol. Its IUPAC name is methyl 4-[[2-(4-fluorophenyl)sulfanylacetyl]amino]piperidine-1-carboxylate.
| Compound Name | methyl 4-[[2-(4-fluorophenyl)sulfanylacetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86841431 |
| Molecular Formula | C15H19FN2O3S |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | methyl 4-[[2-(4-fluorophenyl)sulfanylacetyl]amino]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(NC(=O)CSc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C15H19FN2O3S/c1-21-15(20)18-8-6-12(7-9-18)17-14(19)10-22-13-4-2-11(16)3-5-13/h2-5,12H,6-10H2,1H3,(H,17,19) |
| InChIKey | SJTYBPOUOFHFEJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |