C13H16FNO2S — CID 101433552
methyl 2-[(4-fluorophenyl)sulfanylmethyl]pyrrolidine-1-carboxylate (PubChem CID 101433552) has the molecular formula C13H16FNO2S and a molecular weight of 269.34 g/mol. Its IUPAC name is methyl 2-[(4-fluorophenyl)sulfanylmethyl]pyrrolidine-1-carboxylate.
| Compound Name | methyl 2-[(4-fluorophenyl)sulfanylmethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 101433552 |
| Molecular Formula | C13H16FNO2S |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | methyl 2-[(4-fluorophenyl)sulfanylmethyl]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1CCCC1CSc1ccc(F)cc1 |
| InChI | InChI=1S/C13H16FNO2S/c1-17-13(16)15-8-2-3-11(15)9-18-12-6-4-10(14)5-7-12/h4-7,11H,2-3,8-9H2,1H3 |
| InChIKey | BOVQIFXNYVPEAF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |