C22H35N3O3S — CID 86845593
N-(1-propan-2-ylpiperidin-4-yl)-4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)butanamide (PubChem CID 86845593) has the molecular formula C22H35N3O3S and a molecular weight of 421.61 g/mol. Its IUPAC name is N-(1-propan-2-ylpiperidin-4-yl)-4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)butanamide.
| Compound Name | N-(1-propan-2-ylpiperidin-4-yl)-4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 86845593 |
| Molecular Formula | C22H35N3O3S |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | N-(1-propan-2-ylpiperidin-4-yl)-4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)butanamide |
| SMILES | CC(C)N1CCC(NC(=O)CCCNS(=O)(=O)c2ccc3c(c2)CCCC3)CC1 |
| InChI | InChI=1S/C22H35N3O3S/c1-17(2)25-14-11-20(12-15-25)24-22(26)8-5-13-23-29(27,28)21-10-9-18-6-3-4-7-19(18)16-21/h9-10,16-17,20,23H,3-8,11-15H2,1-2H3,(H,24,26) |
| InChIKey | ANFYUSHGKCCJAJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|