C20H27N3O3S2 — CID 86886275
N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]-4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)butanamide (PubChem CID 86886275) has the molecular formula C20H27N3O3S2 and a molecular weight of 421.59 g/mol. Its IUPAC name is N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]-4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)butanamide.
| Compound Name | N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]-4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 86886275 |
| Molecular Formula | C20H27N3O3S2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]-4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)butanamide |
| SMILES | Cc1csc(C(C)NC(=O)CCCNS(=O)(=O)c2ccc3c(c2)CCCC3)n1 |
| InChI | InChI=1S/C20H27N3O3S2/c1-14-13-27-20(22-14)15(2)23-19(24)8-5-11-21-28(25,26)18-10-9-16-6-3-4-7-17(16)12-18/h9-10,12-13,15,21H,3-8,11H2,1-2H3,(H,23,24) |
| InChIKey | JDAPSOHVIWYHSR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|