C20H21F3N2O3S — CID 86893320
4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)-N-(2,4,5-trifluorophenyl)butanamide (PubChem CID 86893320) has the molecular formula C20H21F3N2O3S and a molecular weight of 426.46 g/mol. Its IUPAC name is 4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)-N-(2,4,5-trifluorophenyl)butanamide.
| Compound Name | 4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)-N-(2,4,5-trifluorophenyl)butanamide |
|---|---|
| PubChem CID | 86893320 |
| Molecular Formula | C20H21F3N2O3S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)-N-(2,4,5-trifluorophenyl)butanamide |
| SMILES | O=C(CCCNS(=O)(=O)c1ccc2c(c1)CCCC2)Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C20H21F3N2O3S/c21-16-11-18(23)19(12-17(16)22)25-20(26)6-3-9-24-29(27,28)15-8-7-13-4-1-2-5-14(13)10-15/h7-8,10-12,24H,1-6,9H2,(H,25,26) |
| InChIKey | JQFUNWZTBPPDSD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|