C17H23F4N3O2 — CID 86846956
N-(2-fluorophenyl)-2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]acetamide (PubChem CID 86846956) has the molecular formula C17H23F4N3O2 and a molecular weight of 377.38 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-fluorophenyl)-2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 86846956 |
| Molecular Formula | C17H23F4N3O2 |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-(2-fluorophenyl)-2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(CCCOCC(F)(F)F)CC1)Nc1ccccc1F |
| InChI | InChI=1S/C17H23F4N3O2/c18-14-4-1-2-5-15(14)22-16(25)12-24-9-7-23(8-10-24)6-3-11-26-13-17(19,20)21/h1-2,4-5H,3,6-13H2,(H,22,25) |
| InChIKey | QQFHTLHGDGDRIE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|