C26H24N4O3 — CID 86848803
4-[[[2-(4-methoxyphenyl)acetyl]amino]methyl]-N-(1-phenylpyrazol-4-yl)benzamide (PubChem CID 86848803) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is 4-[[[2-(4-methoxyphenyl)acetyl]amino]methyl]-N-(1-phenylpyrazol-4-yl)benzamide.
| Compound Name | 4-[[[2-(4-methoxyphenyl)acetyl]amino]methyl]-N-(1-phenylpyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 86848803 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 4-[[[2-(4-methoxyphenyl)acetyl]amino]methyl]-N-(1-phenylpyrazol-4-yl)benzamide |
| SMILES | COc1ccc(CC(=O)NCc2ccc(C(=O)Nc3cnn(-c4ccccc4)c3)cc2)cc1 |
| InChI | InChI=1S/C26H24N4O3/c1-33-24-13-9-19(10-14-24)15-25(31)27-16-20-7-11-21(12-8-20)26(32)29-22-17-28-30(18-22)23-5-3-2-4-6-23/h2-14,17-18H,15-16H2,1H3,(H,27,31)(H,29,32) |
| InChIKey | BICJGBLRLQYIMF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |