C20H23N3O2S — CID 86855596
2-(2,5-dimethylpyrrol-1-yl)-N-[4-(2-oxo-1-pyridinyl)butyl]thiophene-3-carboxamide (PubChem CID 86855596) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrrol-1-yl)-N-[4-(2-oxo-1-pyridinyl)butyl]thiophene-3-carboxamide.
| Compound Name | 2-(2,5-dimethylpyrrol-1-yl)-N-[4-(2-oxo-1-pyridinyl)butyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 86855596 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2-(2,5-dimethylpyrrol-1-yl)-N-[4-(2-oxo-1-pyridinyl)butyl]thiophene-3-carboxamide |
| SMILES | Cc1ccc(C)n1-c1sccc1C(=O)NCCCCn1ccccc1=O |
| InChI | InChI=1S/C20H23N3O2S/c1-15-8-9-16(2)23(15)20-17(10-14-26-20)19(25)21-11-4-6-13-22-12-5-3-7-18(22)24/h3,5,7-10,12,14H,4,6,11,13H2,1-2H3,(H,21,25) |
| InChIKey | PECDMFAIQJIDOK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|