C23H22F3N3O3 — CID 86860963
methyl 2-[2-[(2,2,2-trifluoro-1-phenylethyl)amino]acetyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate (PubChem CID 86860963) has the molecular formula C23H22F3N3O3 and a molecular weight of 445.44 g/mol. Its IUPAC name is methyl 2-[2-[(2,2,2-trifluoro-1-phenylethyl)amino]acetyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate.
| Compound Name | methyl 2-[2-[(2,2,2-trifluoro-1-phenylethyl)amino]acetyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
|---|---|
| PubChem CID | 86860963 |
| Molecular Formula | C23H22F3N3O3 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | methyl 2-[2-[(2,2,2-trifluoro-1-phenylethyl)amino]acetyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]c3c(c2c1)CN(C(=O)CNC(c1ccccc1)C(F)(F)F)CC3 |
| InChI | InChI=1S/C23H22F3N3O3/c1-32-22(31)15-7-8-18-16(11-15)17-13-29(10-9-19(17)28-18)20(30)12-27-21(23(24,25)26)14-5-3-2-4-6-14/h2-8,11,21,27-28H,9-10,12-13H2,1H3 |
| InChIKey | JMRVNKFPODZIMJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|