C18H20F2N2O3 — CID 86861584
2,4-difluoro-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-6-hydroxybenzamide (PubChem CID 86861584) has the molecular formula C18H20F2N2O3 and a molecular weight of 350.37 g/mol. Its IUPAC name is 2,4-difluoro-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-6-hydroxybenzamide.
| Compound Name | 2,4-difluoro-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-6-hydroxybenzamide |
|---|---|
| PubChem CID | 86861584 |
| Molecular Formula | C18H20F2N2O3 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2,4-difluoro-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-6-hydroxybenzamide |
| SMILES | O=C(NCC(c1ccco1)N1CCCCC1)c1c(O)cc(F)cc1F |
| InChI | InChI=1S/C18H20F2N2O3/c19-12-9-13(20)17(15(23)10-12)18(24)21-11-14(16-5-4-8-25-16)22-6-2-1-3-7-22/h4-5,8-10,14,23H,1-3,6-7,11H2,(H,21,24) |
| InChIKey | HJUSPUFKSGBNBU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |