C16H24N4O2 — CID 86862433
2-pyrazol-1-ylethyl 1-tert-butyl-5-propan-2-ylpyrazole-3-carboxylate (PubChem CID 86862433) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-pyrazol-1-ylethyl 1-tert-butyl-5-propan-2-ylpyrazole-3-carboxylate.
| Compound Name | 2-pyrazol-1-ylethyl 1-tert-butyl-5-propan-2-ylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 86862433 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 2-pyrazol-1-ylethyl 1-tert-butyl-5-propan-2-ylpyrazole-3-carboxylate |
| SMILES | CC(C)c1cc(C(=O)OCCn2cccn2)nn1C(C)(C)C |
| InChI | InChI=1S/C16H24N4O2/c1-12(2)14-11-13(18-20(14)16(3,4)5)15(21)22-10-9-19-8-6-7-17-19/h6-8,11-12H,9-10H2,1-5H3 |
| InChIKey | ASBACNBYVZGLGU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |