C18H13F2N3O2 — CID 86864531
N'-(2,5-difluorophenyl)-N-(quinolin-8-ylmethyl)oxamide (PubChem CID 86864531) has the molecular formula C18H13F2N3O2 and a molecular weight of 341.32 g/mol. Its IUPAC name is N'-(2,5-difluorophenyl)-N-(quinolin-8-ylmethyl)oxamide.
| Compound Name | N'-(2,5-difluorophenyl)-N-(quinolin-8-ylmethyl)oxamide |
|---|---|
| PubChem CID | 86864531 |
| Molecular Formula | C18H13F2N3O2 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N'-(2,5-difluorophenyl)-N-(quinolin-8-ylmethyl)oxamide |
| SMILES | O=C(NCc1cccc2cccnc12)C(=O)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C18H13F2N3O2/c19-13-6-7-14(20)15(9-13)23-18(25)17(24)22-10-12-4-1-3-11-5-2-8-21-16(11)12/h1-9H,10H2,(H,22,24)(H,23,25) |
| InChIKey | HDMRMNNGDFPYER-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|