C18H10F5N3O2 — CID 86864533
N'-(2,3,4,5,6-pentafluorophenyl)-N-(quinolin-8-ylmethyl)oxamide (PubChem CID 86864533) has the molecular formula C18H10F5N3O2 and a molecular weight of 395.29 g/mol. Its IUPAC name is N'-(2,3,4,5,6-pentafluorophenyl)-N-(quinolin-8-ylmethyl)oxamide.
| Compound Name | N'-(2,3,4,5,6-pentafluorophenyl)-N-(quinolin-8-ylmethyl)oxamide |
|---|---|
| PubChem CID | 86864533 |
| Molecular Formula | C18H10F5N3O2 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | N'-(2,3,4,5,6-pentafluorophenyl)-N-(quinolin-8-ylmethyl)oxamide |
| SMILES | O=C(NCc1cccc2cccnc12)C(=O)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H10F5N3O2/c19-10-11(20)13(22)16(14(23)12(10)21)26-18(28)17(27)25-7-9-4-1-3-8-5-2-6-24-15(8)9/h1-6H,7H2,(H,25,27)(H,26,28) |
| InChIKey | NGOFCFAGJPQLBV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|