C20H26FN3O3 — CID 86868379
N-[3-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]propyl]-N-methyl-2-(oxolan-2-ylmethoxy)acetamide (PubChem CID 86868379) has the molecular formula C20H26FN3O3 and a molecular weight of 375.44 g/mol. Its IUPAC name is N-[3-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]propyl]-N-methyl-2-(oxolan-2-ylmethoxy)acetamide.
| Compound Name | N-[3-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]propyl]-N-methyl-2-(oxolan-2-ylmethoxy)acetamide |
|---|---|
| PubChem CID | 86868379 |
| Molecular Formula | C20H26FN3O3 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | N-[3-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]propyl]-N-methyl-2-(oxolan-2-ylmethoxy)acetamide |
| SMILES | CN(CCCc1cc(-c2cccc(F)c2)n[nH]1)C(=O)COCC1CCCO1 |
| InChI | InChI=1S/C20H26FN3O3/c1-24(20(25)14-26-13-18-8-4-10-27-18)9-3-7-17-12-19(23-22-17)15-5-2-6-16(21)11-15/h2,5-6,11-12,18H,3-4,7-10,13-14H2,1H3,(H,22,23) |
| InChIKey | WYZCTQPPKAATRG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |