C24H18N4O2S — CID 86873323
N-(1H-indol-2-ylmethyl)-4-oxo-3-phenyl-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 86873323) has the molecular formula C24H18N4O2S and a molecular weight of 426.50 g/mol. Its IUPAC name is N-(1H-indol-2-ylmethyl)-4-oxo-3-phenyl-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-(1H-indol-2-ylmethyl)-4-oxo-3-phenyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 86873323 |
| Molecular Formula | C24H18N4O2S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | N-(1H-indol-2-ylmethyl)-4-oxo-3-phenyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | O=C(NCc1cc2ccccc2[nH]1)c1ccc2c(=O)n(-c3ccccc3)c(=S)[nH]c2c1 |
| InChI | InChI=1S/C24H18N4O2S/c29-22(25-14-17-12-15-6-4-5-9-20(15)26-17)16-10-11-19-21(13-16)27-24(31)28(23(19)30)18-7-2-1-3-8-18/h1-13,26H,14H2,(H,25,29)(H,27,31) |
| InChIKey | XUTWFSXDPBJAPF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|