C19H29BrN2O2S — CID 86873854
N-[(4-bromothiophen-2-yl)methyl]-2-(4-cyclohexyloxypiperidin-1-yl)-N-methylacetamide (PubChem CID 86873854) has the molecular formula C19H29BrN2O2S and a molecular weight of 429.42 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-(4-cyclohexyloxypiperidin-1-yl)-N-methylacetamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-(4-cyclohexyloxypiperidin-1-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 86873854 |
| Molecular Formula | C19H29BrN2O2S |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-(4-cyclohexyloxypiperidin-1-yl)-N-methylacetamide |
| SMILES | CN(Cc1cc(Br)cs1)C(=O)CN1CCC(OC2CCCCC2)CC1 |
| InChI | InChI=1S/C19H29BrN2O2S/c1-21(12-18-11-15(20)14-25-18)19(23)13-22-9-7-17(8-10-22)24-16-5-3-2-4-6-16/h11,14,16-17H,2-10,12-13H2,1H3 |
| InChIKey | CTDKRPOOFRRANE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |