C22H32N4O3 — CID 86876277
2-cyclohexyl-N-[1-[2-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]hydrazinyl]-1-oxopropan-2-yl]acetamide (PubChem CID 86876277) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-cyclohexyl-N-[1-[2-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]hydrazinyl]-1-oxopropan-2-yl]acetamide.
| Compound Name | 2-cyclohexyl-N-[1-[2-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]hydrazinyl]-1-oxopropan-2-yl]acetamide |
|---|---|
| PubChem CID | 86876277 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 2-cyclohexyl-N-[1-[2-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]hydrazinyl]-1-oxopropan-2-yl]acetamide |
| SMILES | CC(NC(=O)CC1CCCCC1)C(=O)NNC(=O)CN1CCCc2ccccc21 |
| InChI | InChI=1S/C22H32N4O3/c1-16(23-20(27)14-17-8-3-2-4-9-17)22(29)25-24-21(28)15-26-13-7-11-18-10-5-6-12-19(18)26/h5-6,10,12,16-17H,2-4,7-9,11,13-15H2,1H3,(H,23,27)(H,24,28)(H,25,29) |
| InChIKey | IYPVMHOQHWHTAS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|