C19H16FN5O3S — CID 86878071
[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]methanone (PubChem CID 86878071) has the molecular formula C19H16FN5O3S and a molecular weight of 413.43 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1,3-thiazol-4-yl]-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]methanone.
| Compound Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 86878071 |
| Molecular Formula | C19H16FN5O3S |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]-[4-(5-nitro-2-pyridinyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1csc(-c2ccc(F)cc2)n1)N1CCN(c2ccc([N+](=O)[O-])cn2)CC1 |
| InChI | InChI=1S/C19H16FN5O3S/c20-14-3-1-13(2-4-14)18-22-16(12-29-18)19(26)24-9-7-23(8-10-24)17-6-5-15(11-21-17)25(27)28/h1-6,11-12H,7-10H2 |
| InChIKey | YIXZJSMDNLNZPN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|