C21H27ClN2O4S — CID 86879551
2-chloro-5-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]sulfonylmethyl]pyridine (PubChem CID 86879551) has the molecular formula C21H27ClN2O4S and a molecular weight of 438.98 g/mol. Its IUPAC name is 2-chloro-5-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]sulfonylmethyl]pyridine.
| Compound Name | 2-chloro-5-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]sulfonylmethyl]pyridine |
|---|---|
| PubChem CID | 86879551 |
| Molecular Formula | C21H27ClN2O4S |
| Molecular Weight | 438.98 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 2-chloro-5-[[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]sulfonylmethyl]pyridine |
| SMILES | COc1cc(CCC2CCN(S(=O)(=O)Cc3ccc(Cl)nc3)CC2)cc(OC)c1 |
| InChI | InChI=1S/C21H27ClN2O4S/c1-27-19-11-17(12-20(13-19)28-2)4-3-16-7-9-24(10-8-16)29(25,26)15-18-5-6-21(22)23-14-18/h5-6,11-14,16H,3-4,7-10,15H2,1-2H3 |
| InChIKey | QTLCZHYGPWAUQU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.98 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|