C19H29NO4S — CID 134813124
4-[2-(4-methoxyphenyl)ethyl]-1-(oxolan-2-ylmethylsulfonyl)piperidine (PubChem CID 134813124) has the molecular formula C19H29NO4S and a molecular weight of 367.51 g/mol. Its IUPAC name is 4-[2-(4-methoxyphenyl)ethyl]-1-(oxolan-2-ylmethylsulfonyl)piperidine.
| Compound Name | 4-[2-(4-methoxyphenyl)ethyl]-1-(oxolan-2-ylmethylsulfonyl)piperidine |
|---|---|
| PubChem CID | 134813124 |
| Molecular Formula | C19H29NO4S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 4-[2-(4-methoxyphenyl)ethyl]-1-(oxolan-2-ylmethylsulfonyl)piperidine |
| SMILES | COc1ccc(CCC2CCN(S(=O)(=O)CC3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C19H29NO4S/c1-23-18-8-6-16(7-9-18)4-5-17-10-12-20(13-11-17)25(21,22)15-19-3-2-14-24-19/h6-9,17,19H,2-5,10-15H2,1H3 |
| InChIKey | PPTGSNICQDYTQC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |