C23H25N5O3 — CID 86880160
1-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-3-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]urea (PubChem CID 86880160) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is 1-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-3-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]urea.
| Compound Name | 1-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-3-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 86880160 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 1-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-3-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]urea |
| SMILES | C#CCOc1cc(CNC(=O)NCc2ccc(-n3nc(C)cc3C)nc2)ccc1OC |
| InChI | InChI=1S/C23H25N5O3/c1-5-10-31-21-12-18(6-8-20(21)30-4)13-25-23(29)26-15-19-7-9-22(24-14-19)28-17(3)11-16(2)27-28/h1,6-9,11-12,14H,10,13,15H2,2-4H3,(H2,25,26,29) |
| InChIKey | ASOMZCBFPAZEPV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|