C23H24N4O3S — CID 86880364
N-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide (PubChem CID 86880364) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is N-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide.
| Compound Name | N-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide |
|---|---|
| PubChem CID | 86880364 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide |
| SMILES | C#CCOc1cc(CNC(=O)CCn2c(-c3ccc(C)cc3)n[nH]c2=S)ccc1OC |
| InChI | InChI=1S/C23H24N4O3S/c1-4-13-30-20-14-17(7-10-19(20)29-3)15-24-21(28)11-12-27-22(25-26-23(27)31)18-8-5-16(2)6-9-18/h1,5-10,14H,11-13,15H2,2-3H3,(H,24,28)(H,26,31) |
| InChIKey | OTKDJBYVQBKOMU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|