C23H20FN3O3S — CID 86881173
N'-[1-(5-fluoro-3-methyl-1-benzofuran-2-yl)ethyl]-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]oxamide (PubChem CID 86881173) has the molecular formula C23H20FN3O3S and a molecular weight of 437.50 g/mol. Its IUPAC name is N'-[1-(5-fluoro-3-methyl-1-benzofuran-2-yl)ethyl]-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]oxamide.
| Compound Name | N'-[1-(5-fluoro-3-methyl-1-benzofuran-2-yl)ethyl]-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 86881173 |
| Molecular Formula | C23H20FN3O3S |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | N'-[1-(5-fluoro-3-methyl-1-benzofuran-2-yl)ethyl]-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]oxamide |
| SMILES | Cc1nc(-c2ccc(NC(=O)C(=O)NC(C)c3oc4ccc(F)cc4c3C)cc2)cs1 |
| InChI | InChI=1S/C23H20FN3O3S/c1-12-18-10-16(24)6-9-20(18)30-21(12)13(2)25-22(28)23(29)27-17-7-4-15(5-8-17)19-11-31-14(3)26-19/h4-11,13H,1-3H3,(H,25,28)(H,27,29) |
| InChIKey | QNYKFWLGEXSFBB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|