C23H24FN3O4 — CID 86881184
N'-[1-(5-fluoro-3-methyl-1-benzofuran-2-yl)ethyl]-N-[3-(2-methylpropanoylamino)phenyl]oxamide (PubChem CID 86881184) has the molecular formula C23H24FN3O4 and a molecular weight of 425.46 g/mol. Its IUPAC name is N'-[1-(5-fluoro-3-methyl-1-benzofuran-2-yl)ethyl]-N-[3-(2-methylpropanoylamino)phenyl]oxamide.
| Compound Name | N'-[1-(5-fluoro-3-methyl-1-benzofuran-2-yl)ethyl]-N-[3-(2-methylpropanoylamino)phenyl]oxamide |
|---|---|
| PubChem CID | 86881184 |
| Molecular Formula | C23H24FN3O4 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | N'-[1-(5-fluoro-3-methyl-1-benzofuran-2-yl)ethyl]-N-[3-(2-methylpropanoylamino)phenyl]oxamide |
| SMILES | Cc1c(C(C)NC(=O)C(=O)Nc2cccc(NC(=O)C(C)C)c2)oc2ccc(F)cc12 |
| InChI | InChI=1S/C23H24FN3O4/c1-12(2)21(28)26-16-6-5-7-17(11-16)27-23(30)22(29)25-14(4)20-13(3)18-10-15(24)8-9-19(18)31-20/h5-12,14H,1-4H3,(H,25,29)(H,26,28)(H,27,30) |
| InChIKey | LICSMSGJCPZENX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|