C22H23FN2O4 — CID 86881162
N-(4-ethoxy-2-methylphenyl)-N'-[1-(5-fluoro-3-methyl-1-benzofuran-2-yl)ethyl]oxamide (PubChem CID 86881162) has the molecular formula C22H23FN2O4 and a molecular weight of 398.43 g/mol. Its IUPAC name is N-(4-ethoxy-2-methylphenyl)-N'-[1-(5-fluoro-3-methyl-1-benzofuran-2-yl)ethyl]oxamide.
| Compound Name | N-(4-ethoxy-2-methylphenyl)-N'-[1-(5-fluoro-3-methyl-1-benzofuran-2-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 86881162 |
| Molecular Formula | C22H23FN2O4 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-(4-ethoxy-2-methylphenyl)-N'-[1-(5-fluoro-3-methyl-1-benzofuran-2-yl)ethyl]oxamide |
| SMILES | CCOc1ccc(NC(=O)C(=O)NC(C)c2oc3ccc(F)cc3c2C)c(C)c1 |
| InChI | InChI=1S/C22H23FN2O4/c1-5-28-16-7-8-18(12(2)10-16)25-22(27)21(26)24-14(4)20-13(3)17-11-15(23)6-9-19(17)29-20/h6-11,14H,5H2,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | CHIZFYMXTJUBDJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|